C25H27N3O5S — CID 155303787
N-[3-(dimethylsulfamoyl)phenyl]-N'-[3-(furan-2-yl)phenyl]-N-methyl-2-prop-1-en-2-ylpropanediamide (PubChem CID 155303787) has the molecular formula C25H27N3O5S and a molecular weight of 481.57 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-N'-[3-(furan-2-yl)phenyl]-N-methyl-2-prop-1-en-2-ylpropanediamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-N'-[3-(furan-2-yl)phenyl]-N-methyl-2-prop-1-en-2-ylpropanediamide |
|---|---|
| PubChem CID | 155303787 |
| Molecular Formula | C25H27N3O5S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-N'-[3-(furan-2-yl)phenyl]-N-methyl-2-prop-1-en-2-ylpropanediamide |
| SMILES | C=C(C)C(C(=O)Nc1cccc(-c2ccco2)c1)C(=O)N(C)c1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C25H27N3O5S/c1-17(2)23(24(29)26-19-10-6-9-18(15-19)22-13-8-14-33-22)25(30)28(5)20-11-7-12-21(16-20)34(31,32)27(3)4/h6-16,23H,1H2,2-5H3,(H,26,29) |
| InChIKey | WYYOGSJRVNQREC-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 99.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|