C23H24N6O4S — CID 176781463
N-[3-(dimethylsulfamoyl)phenyl]-2-ethanimidoyl-N'-(3-pyrazin-2-ylphenyl)propanediamide (PubChem CID 176781463) has the molecular formula C23H24N6O4S and a molecular weight of 480.55 g/mol. Its IUPAC name is N-[3-(dimethylsulfamoyl)phenyl]-2-ethanimidoyl-N'-(3-pyrazin-2-ylphenyl)propanediamide.
| Compound Name | N-[3-(dimethylsulfamoyl)phenyl]-2-ethanimidoyl-N'-(3-pyrazin-2-ylphenyl)propanediamide |
|---|---|
| PubChem CID | 176781463 |
| Molecular Formula | C23H24N6O4S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.16 |
| IUPAC Name | N-[3-(dimethylsulfamoyl)phenyl]-2-ethanimidoyl-N'-(3-pyrazin-2-ylphenyl)propanediamide |
| SMILES | [H]/N=C(\C)C(C(=O)Nc1cccc(-c2cnccn2)c1)C(=O)Nc1cccc(S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C23H24N6O4S/c1-15(24)21(23(31)28-18-8-5-9-19(13-18)34(32,33)29(2)3)22(30)27-17-7-4-6-16(12-17)20-14-25-10-11-26-20/h4-14,21,24H,1-3H3,(H,27,30)(H,28,31)/b24-15+ |
| InChIKey | FHNZPLCTXHFICU-BUVRLJJBSA-N |
| XLogP | 2.63 |
| TPSA | 145.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|