C23H21N5O4 — CID 176781423
methyl 3-[[3-imino-2-[(3-pyrazin-2-ylphenyl)carbamoyl]butanoyl]amino]benzoate (PubChem CID 176781423) has the molecular formula C23H21N5O4 and a molecular weight of 431.45 g/mol. Its IUPAC name is methyl 3-[[3-imino-2-[(3-pyrazin-2-ylphenyl)carbamoyl]butanoyl]amino]benzoate.
| Compound Name | methyl 3-[[3-imino-2-[(3-pyrazin-2-ylphenyl)carbamoyl]butanoyl]amino]benzoate |
|---|---|
| PubChem CID | 176781423 |
| Molecular Formula | C23H21N5O4 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | methyl 3-[[3-imino-2-[(3-pyrazin-2-ylphenyl)carbamoyl]butanoyl]amino]benzoate |
| SMILES | [H]/N=C(\C)C(C(=O)Nc1cccc(C(=O)OC)c1)C(=O)Nc1cccc(-c2cnccn2)c1 |
| InChI | InChI=1S/C23H21N5O4/c1-14(24)20(22(30)28-18-8-4-6-16(12-18)23(31)32-2)21(29)27-17-7-3-5-15(11-17)19-13-25-9-10-26-19/h3-13,20,24H,1-2H3,(H,27,29)(H,28,30)/b24-14+ |
| InChIKey | MAZLAINWMDYRAZ-ZVHZXABRSA-N |
| XLogP | 3.16 |
| TPSA | 134.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|