C22H20N4O2 — CID 176781456
2-ethanimidoyl-N-phenyl-N'-(3-pyridin-4-ylphenyl)propanediamide (PubChem CID 176781456) has the molecular formula C22H20N4O2 and a molecular weight of 372.43 g/mol. Its IUPAC name is 2-ethanimidoyl-N-phenyl-N'-(3-pyridin-4-ylphenyl)propanediamide.
| Compound Name | 2-ethanimidoyl-N-phenyl-N'-(3-pyridin-4-ylphenyl)propanediamide |
|---|---|
| PubChem CID | 176781456 |
| Molecular Formula | C22H20N4O2 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | 2-ethanimidoyl-N-phenyl-N'-(3-pyridin-4-ylphenyl)propanediamide |
| SMILES | [H]/N=C(\C)C(C(=O)Nc1ccccc1)C(=O)Nc1cccc(-c2ccncc2)c1 |
| InChI | InChI=1S/C22H20N4O2/c1-15(23)20(21(27)25-18-7-3-2-4-8-18)22(28)26-19-9-5-6-17(14-19)16-10-12-24-13-11-16/h2-14,20,23H,1H3,(H,25,27)(H,26,28)/b23-15+ |
| InChIKey | PWGJQRXRYAHCJY-HZHRSRAPSA-N |
| XLogP | 3.98 |
| TPSA | 94.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|