C24H25F2N5O3 — CID 155721712
N-[3-(1,1-difluoroethyl)phenyl]-2-ethanimidoyl-N'-(4-methoxy-3-pyrazin-2-ylphenyl)propanediamide;molecular hydrogen (PubChem CID 155721712) has the molecular formula C24H25F2N5O3 and a molecular weight of 469.49 g/mol. Its IUPAC name is N-[3-(1,1-difluoroethyl)phenyl]-2-ethanimidoyl-N'-(4-methoxy-3-pyrazin-2-ylphenyl)propanediamide;molecular hydrogen.
| Compound Name | N-[3-(1,1-difluoroethyl)phenyl]-2-ethanimidoyl-N'-(4-methoxy-3-pyrazin-2-ylphenyl)propanediamide;molecular hydrogen |
|---|---|
| PubChem CID | 155721712 |
| Molecular Formula | C24H25F2N5O3 |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | N-[3-(1,1-difluoroethyl)phenyl]-2-ethanimidoyl-N'-(4-methoxy-3-pyrazin-2-ylphenyl)propanediamide;molecular hydrogen |
| SMILES | [H]/N=C(\C)C(C(=O)Nc1cccc(C(C)(F)F)c1)C(=O)Nc1ccc(OC)c(-c2cnccn2)c1.[H][H] |
| InChI | InChI=1S/C24H23F2N5O3.H2/c1-14(27)21(22(32)30-16-6-4-5-15(11-16)24(2,25)26)23(33)31-17-7-8-20(34-3)18(12-17)19-13-28-9-10-29-19;/h4-13,21,27H,1-3H3,(H,30,32)(H,31,33);1H/b27-14+; |
| InChIKey | UMAMVAQIEQJIOJ-RRIBZKRYSA-N |
| XLogP | 4.74 |
| TPSA | 117.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|