C25H25F2N5O3 — CID 174262293
(3Z)-3-[amino-(4-methoxy-3-pyridin-2-ylphenyl)hydrazinylidene]-N-[3-(1,1-difluoroethyl)phenyl]-2-formylbutanamide (PubChem CID 174262293) has the molecular formula C25H25F2N5O3 and a molecular weight of 481.50 g/mol. Its IUPAC name is (3Z)-3-[amino-(4-methoxy-3-pyridin-2-ylphenyl)hydrazinylidene]-N-[3-(1,1-difluoroethyl)phenyl]-2-formylbutanamide.
| Compound Name | (3Z)-3-[amino-(4-methoxy-3-pyridin-2-ylphenyl)hydrazinylidene]-N-[3-(1,1-difluoroethyl)phenyl]-2-formylbutanamide |
|---|---|
| PubChem CID | 174262293 |
| Molecular Formula | C25H25F2N5O3 |
| Molecular Weight | 481.50 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | (3Z)-3-[amino-(4-methoxy-3-pyridin-2-ylphenyl)hydrazinylidene]-N-[3-(1,1-difluoroethyl)phenyl]-2-formylbutanamide |
| SMILES | COc1ccc(N(N)/N=C(/C)C(C=O)C(=O)Nc2cccc(C(C)(F)F)c2)cc1-c1ccccn1 |
| InChI | InChI=1S/C25H25F2N5O3/c1-16(21(15-33)24(34)30-18-8-6-7-17(13-18)25(2,26)27)31-32(28)19-10-11-23(35-3)20(14-19)22-9-4-5-12-29-22/h4-15,21H,28H2,1-3H3,(H,30,34)/b31-16- |
| InChIKey | FPRFCVYABRWARQ-ACXHZZMFSA-N |
| XLogP | 4.38 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|