C22H23F4N3O3 — CID 155311365
(3Z)-3-[[4-(difluoromethoxy)phenyl]-formylhydrazinylidene]-N-[3-(1,1-difluoropropyl)phenyl]-2-methylbutanamide (PubChem CID 155311365) has the molecular formula C22H23F4N3O3 and a molecular weight of 453.44 g/mol. Its IUPAC name is (3Z)-3-[[4-(difluoromethoxy)phenyl]-formylhydrazinylidene]-N-[3-(1,1-difluoropropyl)phenyl]-2-methylbutanamide.
| Compound Name | (3Z)-3-[[4-(difluoromethoxy)phenyl]-formylhydrazinylidene]-N-[3-(1,1-difluoropropyl)phenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 155311365 |
| Molecular Formula | C22H23F4N3O3 |
| Molecular Weight | 453.44 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | (3Z)-3-[[4-(difluoromethoxy)phenyl]-formylhydrazinylidene]-N-[3-(1,1-difluoropropyl)phenyl]-2-methylbutanamide |
| SMILES | CCC(F)(F)c1cccc(NC(=O)C(C)/C(C)=N\N(C=O)c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C22H23F4N3O3/c1-4-22(25,26)16-6-5-7-17(12-16)27-20(31)14(2)15(3)28-29(13-30)18-8-10-19(11-9-18)32-21(23)24/h5-14,21H,4H2,1-3H3,(H,27,31)/b28-15- |
| InChIKey | QJGUSZVOFLNECG-MBTHVWNTSA-N |
| XLogP | 5.40 |
| TPSA | 71.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.44 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|