C21H22F4N4O3 — CID 155304070
(3Z)-3-[[4-(difluoromethoxy)phenyl]-methylhydrazinylidene]-N-[6-(1,1-difluoropropyl)-2-pyridinyl]-2-formylbutanamide (PubChem CID 155304070) has the molecular formula C21H22F4N4O3 and a molecular weight of 454.42 g/mol. Its IUPAC name is (3Z)-3-[[4-(difluoromethoxy)phenyl]-methylhydrazinylidene]-N-[6-(1,1-difluoropropyl)-2-pyridinyl]-2-formylbutanamide.
| Compound Name | (3Z)-3-[[4-(difluoromethoxy)phenyl]-methylhydrazinylidene]-N-[6-(1,1-difluoropropyl)-2-pyridinyl]-2-formylbutanamide |
|---|---|
| PubChem CID | 155304070 |
| Molecular Formula | C21H22F4N4O3 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.16 |
| IUPAC Name | (3Z)-3-[[4-(difluoromethoxy)phenyl]-methylhydrazinylidene]-N-[6-(1,1-difluoropropyl)-2-pyridinyl]-2-formylbutanamide |
| SMILES | CCC(F)(F)c1cccc(NC(=O)C(C=O)/C(C)=N\N(C)c2ccc(OC(F)F)cc2)n1 |
| InChI | InChI=1S/C21H22F4N4O3/c1-4-21(24,25)17-6-5-7-18(26-17)27-19(31)16(12-30)13(2)28-29(3)14-8-10-15(11-9-14)32-20(22)23/h5-12,16,20H,4H2,1-3H3,(H,26,27,31)/b28-13- |
| InChIKey | QAJFHEWISIUINR-QDTIIGTASA-N |
| XLogP | 4.45 |
| TPSA | 83.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|