C15H13F3N2O2 — CID 95597244
(2R)-2-methoxy-2-phenyl-N-[6-(trifluoromethyl)-2-pyridinyl]acetamide (PubChem CID 95597244) has the molecular formula C15H13F3N2O2 and a molecular weight of 310.28 g/mol. Its IUPAC name is (2R)-2-methoxy-2-phenyl-N-[6-(trifluoromethyl)-2-pyridinyl]acetamide.
| Compound Name | (2R)-2-methoxy-2-phenyl-N-[6-(trifluoromethyl)-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 95597244 |
| Molecular Formula | C15H13F3N2O2 |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | (2R)-2-methoxy-2-phenyl-N-[6-(trifluoromethyl)-2-pyridinyl]acetamide |
| SMILES | CO[C@@H](C(=O)Nc1cccc(C(F)(F)F)n1)c1ccccc1 |
| InChI | InChI=1S/C15H13F3N2O2/c1-22-13(10-6-3-2-4-7-10)14(21)20-12-9-5-8-11(19-12)15(16,17)18/h2-9,13H,1H3,(H,19,20,21)/t13-/m1/s1 |
| InChIKey | ZGBOHEQZIYFQMT-CYBMUJFWSA-N |
| XLogP | 3.43 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |