C14H13F3N4O — CID 99604871
1-[(1S)-1-pyridin-3-ylethyl]-3-[6-(trifluoromethyl)-2-pyridinyl]urea (PubChem CID 99604871) has the molecular formula C14H13F3N4O and a molecular weight of 310.28 g/mol. Its IUPAC name is 1-[(1S)-1-pyridin-3-ylethyl]-3-[6-(trifluoromethyl)-2-pyridinyl]urea.
| Compound Name | 1-[(1S)-1-pyridin-3-ylethyl]-3-[6-(trifluoromethyl)-2-pyridinyl]urea |
|---|---|
| PubChem CID | 99604871 |
| Molecular Formula | C14H13F3N4O |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 1-[(1S)-1-pyridin-3-ylethyl]-3-[6-(trifluoromethyl)-2-pyridinyl]urea |
| SMILES | C[C@H](NC(=O)Nc1cccc(C(F)(F)F)n1)c1cccnc1 |
| InChI | InChI=1S/C14H13F3N4O/c1-9(10-4-3-7-18-8-10)19-13(22)21-12-6-2-5-11(20-12)14(15,16)17/h2-9H,1H3,(H2,19,20,21,22)/t9-/m0/s1 |
| InChIKey | KESTZMIQNZKHGS-VIFPVBQESA-N |
| XLogP | 3.38 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |