C15H14N2O4 — CID 63641845
6-[(2-methoxy-2-phenylacetyl)amino]pyridine-2-carboxylic acid (PubChem CID 63641845) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 6-[(2-methoxy-2-phenylacetyl)amino]pyridine-2-carboxylic acid.
| Compound Name | 6-[(2-methoxy-2-phenylacetyl)amino]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 63641845 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 6-[(2-methoxy-2-phenylacetyl)amino]pyridine-2-carboxylic acid |
| SMILES | COC(C(=O)Nc1cccc(C(=O)O)n1)c1ccccc1 |
| InChI | InChI=1S/C15H14N2O4/c1-21-13(10-6-3-2-4-7-10)14(18)17-12-9-5-8-11(16-12)15(19)20/h2-9,13H,1H3,(H,19,20)(H,16,17,18) |
| InChIKey | YPCNGCZSKDOMSA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |