C18H16F5N3O2 — CID 6162109
N-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 6162109) has the molecular formula C18H16F5N3O2 and a molecular weight of 401.34 g/mol. Its IUPAC name is N-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 6162109 |
| Molecular Formula | C18H16F5N3O2 |
| Molecular Weight | 401.34 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | N-[(Z)-1-[4-(difluoromethoxy)phenyl]ethylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | C/C(=N/NC(=O)CNc1cccc(C(F)(F)F)c1)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C18H16F5N3O2/c1-11(12-5-7-15(8-6-12)28-17(19)20)25-26-16(27)10-24-14-4-2-3-13(9-14)18(21,22)23/h2-9,17,24H,10H2,1H3,(H,26,27)/b25-11- |
| InChIKey | VQKWGBOOYQJUFV-GATIEOLUSA-N |
| XLogP | 4.26 |
| TPSA | 62.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.34 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|