C19H24N4O2 — CID 89355003
2-(3-butoxyanilino)-N-[(E)-1-pyridin-4-ylethylideneamino]acetamide (PubChem CID 89355003) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-(3-butoxyanilino)-N-[(E)-1-pyridin-4-ylethylideneamino]acetamide.
| Compound Name | 2-(3-butoxyanilino)-N-[(E)-1-pyridin-4-ylethylideneamino]acetamide |
|---|---|
| PubChem CID | 89355003 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | 2-(3-butoxyanilino)-N-[(E)-1-pyridin-4-ylethylideneamino]acetamide |
| SMILES | CCCCOc1cccc(NCC(=O)N/N=C(\C)c2ccncc2)c1 |
| InChI | InChI=1S/C19H24N4O2/c1-3-4-12-25-18-7-5-6-17(13-18)21-14-19(24)23-22-15(2)16-8-10-20-11-9-16/h5-11,13,21H,3-4,12,14H2,1-2H3,(H,23,24)/b22-15+ |
| InChIKey | IXRJLWVQBNIJEJ-PXLXIMEGSA-N |
| XLogP | 3.21 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|