C19H32N2O2 — CID 54829073
N-tert-butyl-2-(3-heptoxyanilino)acetamide (PubChem CID 54829073) has the molecular formula C19H32N2O2 and a molecular weight of 320.48 g/mol. Its IUPAC name is N-tert-butyl-2-(3-heptoxyanilino)acetamide.
| Compound Name | N-tert-butyl-2-(3-heptoxyanilino)acetamide |
|---|---|
| PubChem CID | 54829073 |
| Molecular Formula | C19H32N2O2 |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.25 |
| IUPAC Name | N-tert-butyl-2-(3-heptoxyanilino)acetamide |
| SMILES | CCCCCCCOc1cccc(NCC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C19H32N2O2/c1-5-6-7-8-9-13-23-17-12-10-11-16(14-17)20-15-18(22)21-19(2,3)4/h10-12,14,20H,5-9,13,15H2,1-4H3,(H,21,22) |
| InChIKey | VRUDXSMDMDZEHL-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|