C17H15F5N2O2 — CID 56538640
N-[[2-(difluoromethoxy)phenyl]methyl]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 56538640) has the molecular formula C17H15F5N2O2 and a molecular weight of 374.31 g/mol. Its IUPAC name is N-[[2-(difluoromethoxy)phenyl]methyl]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 56538640 |
| Molecular Formula | C17H15F5N2O2 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 374.11 |
| IUPAC Name | N-[[2-(difluoromethoxy)phenyl]methyl]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C(F)(F)F)c1)NCc1ccccc1OC(F)F |
| InChI | InChI=1S/C17H15F5N2O2/c18-16(19)26-14-7-2-1-4-11(14)9-24-15(25)10-23-13-6-3-5-12(8-13)17(20,21)22/h1-8,16,23H,9-10H2,(H,24,25) |
| InChIKey | ISMJCIMECMPKSE-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |