C14H12BrF3N2OS — CID 56540445
N-[(5-bromothiophen-2-yl)methyl]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 56540445) has the molecular formula C14H12BrF3N2OS and a molecular weight of 393.23 g/mol. Its IUPAC name is N-[(5-bromothiophen-2-yl)methyl]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[(5-bromothiophen-2-yl)methyl]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 56540445 |
| Molecular Formula | C14H12BrF3N2OS |
| Molecular Weight | 393.23 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | N-[(5-bromothiophen-2-yl)methyl]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C(F)(F)F)c1)NCc1ccc(Br)s1 |
| InChI | InChI=1S/C14H12BrF3N2OS/c15-12-5-4-11(22-12)7-20-13(21)8-19-10-3-1-2-9(6-10)14(16,17)18/h1-6,19H,7-8H2,(H,20,21) |
| InChIKey | UUMJZMJLIWJPBN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.23 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |