C17H18F3N3O3S — CID 56546361
N-[[2-(methanesulfonamido)phenyl]methyl]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 56546361) has the molecular formula C17H18F3N3O3S and a molecular weight of 401.41 g/mol. Its IUPAC name is N-[[2-(methanesulfonamido)phenyl]methyl]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[[2-(methanesulfonamido)phenyl]methyl]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 56546361 |
| Molecular Formula | C17H18F3N3O3S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | N-[[2-(methanesulfonamido)phenyl]methyl]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | CS(=O)(=O)Nc1ccccc1CNC(=O)CNc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H18F3N3O3S/c1-27(25,26)23-15-8-3-2-5-12(15)10-22-16(24)11-21-14-7-4-6-13(9-14)17(18,19)20/h2-9,21,23H,10-11H2,1H3,(H,22,24) |
| InChIKey | JMHOPFAJSWVBRW-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |