C13H15F3N2O — CID 28571844
N-(cyclopropylmethyl)-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 28571844) has the molecular formula C13H15F3N2O and a molecular weight of 272.27 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-(cyclopropylmethyl)-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 28571844 |
| Molecular Formula | C13H15F3N2O |
| Molecular Weight | 272.27 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | N-(cyclopropylmethyl)-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C(F)(F)F)c1)NCC1CC1 |
| InChI | InChI=1S/C13H15F3N2O/c14-13(15,16)10-2-1-3-11(6-10)17-8-12(19)18-7-9-4-5-9/h1-3,6,9,17H,4-5,7-8H2,(H,18,19) |
| InChIKey | VOZQXHWBICXOLO-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.27 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |