C21H25N3O3 — CID 176781455
2-ethanimidoyl-N-(4-ethoxyphenyl)-N'-(3-ethylphenyl)propanediamide (PubChem CID 176781455) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is 2-ethanimidoyl-N-(4-ethoxyphenyl)-N'-(3-ethylphenyl)propanediamide.
| Compound Name | 2-ethanimidoyl-N-(4-ethoxyphenyl)-N'-(3-ethylphenyl)propanediamide |
|---|---|
| PubChem CID | 176781455 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | 2-ethanimidoyl-N-(4-ethoxyphenyl)-N'-(3-ethylphenyl)propanediamide |
| SMILES | [H]/N=C(\C)C(C(=O)Nc1ccc(OCC)cc1)C(=O)Nc1cccc(CC)c1 |
| InChI | InChI=1S/C21H25N3O3/c1-4-15-7-6-8-17(13-15)24-21(26)19(14(3)22)20(25)23-16-9-11-18(12-10-16)27-5-2/h6-13,19,22H,4-5H2,1-3H3,(H,23,25)(H,24,26)/b22-14+ |
| InChIKey | JQWHOJSXTXBKSM-HYARGMPZSA-N |
| XLogP | 3.88 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|