(4-acetamidophenyl) N-(3-ethylphenyl)carbamate

C17H18N2O3 — CID 3406901

IUPAC(4-acetamidophenyl) N-(3-ethylphenyl)carbamate
SMILESCCc1cccc(NC(=O)Oc2ccc(NC(C)=O)cc2)c1
InChIInChI=1S/C17H18N2O3/c1-3-13-5-4-6-15(11-13)19-17(21)22-16-9-7-14(8-10-16)18-12(2)20/h4-11H,3H2,1-2H3,(H,18,20)(H,19,21)
InChIKeyBVFRDNCDNLBZCJ-UHFFFAOYSA-N
MW298.34 g/mol
LogP3.82
Rot. Bonds4

About (4-acetamidophenyl) N-(3-ethylphenyl)carbamate

(4-acetamidophenyl) N-(3-ethylphenyl)carbamate (PubChem CID 3406901) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is (4-acetamidophenyl) N-(3-ethylphenyl)carbamate.

Molecular Properties

Compound Name(4-acetamidophenyl) N-(3-ethylphenyl)carbamate
PubChem CID3406901
Molecular FormulaC17H18N2O3
Molecular Weight298.34 g/mol
Exact Mass298.13
IUPAC Name(4-acetamidophenyl) N-(3-ethylphenyl)carbamate
SMILESCCc1cccc(NC(=O)Oc2ccc(NC(C)=O)cc2)c1
InChIInChI=1S/C17H18N2O3/c1-3-13-5-4-6-15(11-13)19-17(21)22-16-9-7-14(8-10-16)18-12(2)20/h4-11H,3H2,1-2H3,(H,18,20)(H,19,21)
InChIKeyBVFRDNCDNLBZCJ-UHFFFAOYSA-N
XLogP3.82
TPSA67.43 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500298.34
LogP ≤ 53.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze (4-acetamidophenyl) N-(3-ethylphenyl)carbamate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (4-acetamidophenyl) N-(3-ethylphenyl)carbamate?
The IUPAC name of (4-acetamidophenyl) N-(3-ethylphenyl)carbamate (CID 3406901) is (4-acetamidophenyl) N-(3-ethylphenyl)carbamate.
What is the SMILES notation for (4-acetamidophenyl) N-(3-ethylphenyl)carbamate?
The canonical SMILES for (4-acetamidophenyl) N-(3-ethylphenyl)carbamate is CCc1cccc(NC(=O)Oc2ccc(NC(C)=O)cc2)c1.
What is the InChIKey of (4-acetamidophenyl) N-(3-ethylphenyl)carbamate?
The InChIKey is BVFRDNCDNLBZCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c1-3-13-5-4-6-15(11-13)19-17(21)22-16-9-7-14(8-10-16)18-12(2)20/h4-11H,3H2,1-2H3,(H,18,20)(H,19,21).
What are the key properties of (4-acetamidophenyl) N-(3-ethylphenyl)carbamate?
(4-acetamidophenyl) N-(3-ethylphenyl)carbamate has a molecular weight of 298.34 g/mol, XLogP of 3.82, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-acetamidophenyl) N-(3-ethylphenyl)carbamate is sourced from PubChem (CID 3406901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).