C15H12N4O8 — CID 46501916
(2,4,6-trinitrophenyl) N-(3-ethylphenyl)carbamate (PubChem CID 46501916) has the molecular formula C15H12N4O8 and a molecular weight of 376.28 g/mol. Its IUPAC name is (2,4,6-trinitrophenyl) N-(3-ethylphenyl)carbamate.
| Compound Name | (2,4,6-trinitrophenyl) N-(3-ethylphenyl)carbamate |
|---|---|
| PubChem CID | 46501916 |
| Molecular Formula | C15H12N4O8 |
| Molecular Weight | 376.28 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | (2,4,6-trinitrophenyl) N-(3-ethylphenyl)carbamate |
| SMILES | CCc1cccc(NC(=O)Oc2c([N+](=O)[O-])cc([N+](=O)[O-])cc2[N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H12N4O8/c1-2-9-4-3-5-10(6-9)16-15(20)27-14-12(18(23)24)7-11(17(21)22)8-13(14)19(25)26/h3-8H,2H2,1H3,(H,16,20) |
| InChIKey | XOFOLPREFJTYKL-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 167.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.28 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|