C26H24N4O4 — CID 155304324
methyl 3-[ethenyl-[3-methyl-2-[(3-pyrazin-2-ylphenyl)carbamoyl]but-3-enoyl]amino]benzoate (PubChem CID 155304324) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is methyl 3-[ethenyl-[3-methyl-2-[(3-pyrazin-2-ylphenyl)carbamoyl]but-3-enoyl]amino]benzoate.
| Compound Name | methyl 3-[ethenyl-[3-methyl-2-[(3-pyrazin-2-ylphenyl)carbamoyl]but-3-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 155304324 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | methyl 3-[ethenyl-[3-methyl-2-[(3-pyrazin-2-ylphenyl)carbamoyl]but-3-enoyl]amino]benzoate |
| SMILES | C=CN(C(=O)C(C(=C)C)C(=O)Nc1cccc(-c2cnccn2)c1)c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C26H24N4O4/c1-5-30(21-11-7-9-19(15-21)26(33)34-4)25(32)23(17(2)3)24(31)29-20-10-6-8-18(14-20)22-16-27-12-13-28-22/h5-16,23H,1-2H2,3-4H3,(H,29,31) |
| InChIKey | XLNQKAPQFBASCN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|