C12H20N2O2S2 — CID 82900902
4-amino-3-tert-butylsulfanyl-N,N-dimethylbenzenesulfonamide (PubChem CID 82900902) has the molecular formula C12H20N2O2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 4-amino-3-tert-butylsulfanyl-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-amino-3-tert-butylsulfanyl-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 82900902 |
| Molecular Formula | C12H20N2O2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.10 |
| IUPAC Name | 4-amino-3-tert-butylsulfanyl-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N)c(SC(C)(C)C)c1 |
| InChI | InChI=1S/C12H20N2O2S2/c1-12(2,3)17-11-8-9(6-7-10(11)13)18(15,16)14(4)5/h6-8H,13H2,1-5H3 |
| InChIKey | LWXWFIVVCVEVSB-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|