C15H23N3O2S — CID 82898396
4-amino-3-(dicyclopropylmethylamino)-N,N-dimethylbenzenesulfonamide (PubChem CID 82898396) has the molecular formula C15H23N3O2S and a molecular weight of 309.44 g/mol. Its IUPAC name is 4-amino-3-(dicyclopropylmethylamino)-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-amino-3-(dicyclopropylmethylamino)-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 82898396 |
| Molecular Formula | C15H23N3O2S |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.15 |
| IUPAC Name | 4-amino-3-(dicyclopropylmethylamino)-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(N)c(NC(C2CC2)C2CC2)c1 |
| InChI | InChI=1S/C15H23N3O2S/c1-18(2)21(19,20)12-7-8-13(16)14(9-12)17-15(10-3-4-10)11-5-6-11/h7-11,15,17H,3-6,16H2,1-2H3 |
| InChIKey | GBXSYGOVPMRDMZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|