C13H20N4O3S — CID 106251745
4-amino-N,N-dimethyl-3-[(1-methyl-2-oxopyrrolidin-3-yl)amino]benzenesulfonamide (PubChem CID 106251745) has the molecular formula C13H20N4O3S and a molecular weight of 312.40 g/mol. Its IUPAC name is 4-amino-N,N-dimethyl-3-[(1-methyl-2-oxopyrrolidin-3-yl)amino]benzenesulfonamide.
| Compound Name | 4-amino-N,N-dimethyl-3-[(1-methyl-2-oxopyrrolidin-3-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 106251745 |
| Molecular Formula | C13H20N4O3S |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | 4-amino-N,N-dimethyl-3-[(1-methyl-2-oxopyrrolidin-3-yl)amino]benzenesulfonamide |
| SMILES | CN1CCC(Nc2cc(S(=O)(=O)N(C)C)ccc2N)C1=O |
| InChI | InChI=1S/C13H20N4O3S/c1-16(2)21(19,20)9-4-5-10(14)12(8-9)15-11-6-7-17(3)13(11)18/h4-5,8,11,15H,6-7,14H2,1-3H3 |
| InChIKey | IEXQZUFPDXLGCR-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|