C12H18N2O4S2 — CID 43618245
ethyl 2-[2-amino-4-(dimethylsulfamoyl)phenyl]sulfanylacetate (PubChem CID 43618245) has the molecular formula C12H18N2O4S2 and a molecular weight of 318.42 g/mol. Its IUPAC name is ethyl 2-[2-amino-4-(dimethylsulfamoyl)phenyl]sulfanylacetate.
| Compound Name | ethyl 2-[2-amino-4-(dimethylsulfamoyl)phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 43618245 |
| Molecular Formula | C12H18N2O4S2 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | ethyl 2-[2-amino-4-(dimethylsulfamoyl)phenyl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1ccc(S(=O)(=O)N(C)C)cc1N |
| InChI | InChI=1S/C12H18N2O4S2/c1-4-18-12(15)8-19-11-6-5-9(7-10(11)13)20(16,17)14(2)3/h5-7H,4,8,13H2,1-3H3 |
| InChIKey | VEEMOPCECVUPQY-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|