C22H28N2O6S2 — CID 121429504
ethyl 2-[5-[(4-ethylphenyl)-(2-methylpropyl)sulfamoyl]-2-nitrophenyl]sulfanylacetate (PubChem CID 121429504) has the molecular formula C22H28N2O6S2 and a molecular weight of 480.61 g/mol. Its IUPAC name is ethyl 2-[5-[(4-ethylphenyl)-(2-methylpropyl)sulfamoyl]-2-nitrophenyl]sulfanylacetate.
| Compound Name | ethyl 2-[5-[(4-ethylphenyl)-(2-methylpropyl)sulfamoyl]-2-nitrophenyl]sulfanylacetate |
|---|---|
| PubChem CID | 121429504 |
| Molecular Formula | C22H28N2O6S2 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | ethyl 2-[5-[(4-ethylphenyl)-(2-methylpropyl)sulfamoyl]-2-nitrophenyl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1cc(S(=O)(=O)N(CC(C)C)c2ccc(CC)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H28N2O6S2/c1-5-17-7-9-18(10-8-17)23(14-16(3)4)32(28,29)19-11-12-20(24(26)27)21(13-19)31-15-22(25)30-6-2/h7-13,16H,5-6,14-15H2,1-4H3 |
| InChIKey | RAMXTSMYSJRICP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 106.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|