C18H14Cl3NO4S — CID 70548209
ethyl 2-[2-nitro-5-[2-(2,4,6-trichlorophenyl)ethenyl]phenyl]sulfanylacetate (PubChem CID 70548209) has the molecular formula C18H14Cl3NO4S and a molecular weight of 446.74 g/mol. Its IUPAC name is ethyl 2-[2-nitro-5-[2-(2,4,6-trichlorophenyl)ethenyl]phenyl]sulfanylacetate.
| Compound Name | ethyl 2-[2-nitro-5-[2-(2,4,6-trichlorophenyl)ethenyl]phenyl]sulfanylacetate |
|---|---|
| PubChem CID | 70548209 |
| Molecular Formula | C18H14Cl3NO4S |
| Molecular Weight | 446.74 g/mol |
| Exact Mass | 444.97 |
| IUPAC Name | ethyl 2-[2-nitro-5-[2-(2,4,6-trichlorophenyl)ethenyl]phenyl]sulfanylacetate |
| SMILES | CCOC(=O)CSc1cc(C=Cc2c(Cl)cc(Cl)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14Cl3NO4S/c1-2-26-18(23)10-27-17-7-11(4-6-16(17)22(24)25)3-5-13-14(20)8-12(19)9-15(13)21/h3-9H,2,10H2,1H3 |
| InChIKey | UYEZJCRZCKHWPA-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.74 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|