C19H22BrNO4S — CID 86731598
2-bromo-5-[(4-ethylphenyl)-(2-methylpropyl)sulfamoyl]benzoic acid (PubChem CID 86731598) has the molecular formula C19H22BrNO4S and a molecular weight of 440.36 g/mol. Its IUPAC name is 2-bromo-5-[(4-ethylphenyl)-(2-methylpropyl)sulfamoyl]benzoic acid.
| Compound Name | 2-bromo-5-[(4-ethylphenyl)-(2-methylpropyl)sulfamoyl]benzoic acid |
|---|---|
| PubChem CID | 86731598 |
| Molecular Formula | C19H22BrNO4S |
| Molecular Weight | 440.36 g/mol |
| Exact Mass | 439.05 |
| IUPAC Name | 2-bromo-5-[(4-ethylphenyl)-(2-methylpropyl)sulfamoyl]benzoic acid |
| SMILES | CCc1ccc(N(CC(C)C)S(=O)(=O)c2ccc(Br)c(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C19H22BrNO4S/c1-4-14-5-7-15(8-6-14)21(12-13(2)3)26(24,25)16-9-10-18(20)17(11-16)19(22)23/h5-11,13H,4,12H2,1-3H3,(H,22,23) |
| InChIKey | GOBOZEZAYFRJLM-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |