C19H23FN2O4S — CID 174868031
[5-[(4-ethylphenyl)-(2-methylpropyl)sulfamoyl]-2-fluorophenyl] carbamate (PubChem CID 174868031) has the molecular formula C19H23FN2O4S and a molecular weight of 394.47 g/mol. Its IUPAC name is [5-[(4-ethylphenyl)-(2-methylpropyl)sulfamoyl]-2-fluorophenyl] carbamate.
| Compound Name | [5-[(4-ethylphenyl)-(2-methylpropyl)sulfamoyl]-2-fluorophenyl] carbamate |
|---|---|
| PubChem CID | 174868031 |
| Molecular Formula | C19H23FN2O4S |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | [5-[(4-ethylphenyl)-(2-methylpropyl)sulfamoyl]-2-fluorophenyl] carbamate |
| SMILES | CCc1ccc(N(CC(C)C)S(=O)(=O)c2ccc(F)c(OC(N)=O)c2)cc1 |
| InChI | InChI=1S/C19H23FN2O4S/c1-4-14-5-7-15(8-6-14)22(12-13(2)3)27(24,25)16-9-10-17(20)18(11-16)26-19(21)23/h5-11,13H,4,12H2,1-3H3,(H2,21,23) |
| InChIKey | JOEVYDWRAZOSPH-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |