C18H20FNO5S — CID 126480845
methyl 5-[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-2-hydroxybenzoate (PubChem CID 126480845) has the molecular formula C18H20FNO5S and a molecular weight of 381.43 g/mol. Its IUPAC name is methyl 5-[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-2-hydroxybenzoate.
| Compound Name | methyl 5-[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 126480845 |
| Molecular Formula | C18H20FNO5S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | methyl 5-[(4-fluorophenyl)sulfonyl-(2-methylpropyl)amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(N(CC(C)C)S(=O)(=O)c2ccc(F)cc2)ccc1O |
| InChI | InChI=1S/C18H20FNO5S/c1-12(2)11-20(26(23,24)15-7-4-13(19)5-8-15)14-6-9-17(21)16(10-14)18(22)25-3/h4-10,12,21H,11H2,1-3H3 |
| InChIKey | GZCXZLYYQVRMNG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |