C20H23F2NO4S — CID 66978802
methyl 2-fluoro-4-[[(4-fluorophenyl)sulfonyl-pentan-3-ylamino]methyl]benzoate (PubChem CID 66978802) has the molecular formula C20H23F2NO4S and a molecular weight of 411.47 g/mol. Its IUPAC name is methyl 2-fluoro-4-[[(4-fluorophenyl)sulfonyl-pentan-3-ylamino]methyl]benzoate.
| Compound Name | methyl 2-fluoro-4-[[(4-fluorophenyl)sulfonyl-pentan-3-ylamino]methyl]benzoate |
|---|---|
| PubChem CID | 66978802 |
| Molecular Formula | C20H23F2NO4S |
| Molecular Weight | 411.47 g/mol |
| Exact Mass | 411.13 |
| IUPAC Name | methyl 2-fluoro-4-[[(4-fluorophenyl)sulfonyl-pentan-3-ylamino]methyl]benzoate |
| SMILES | CCC(CC)N(Cc1ccc(C(=O)OC)c(F)c1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H23F2NO4S/c1-4-16(5-2)23(28(25,26)17-9-7-15(21)8-10-17)13-14-6-11-18(19(22)12-14)20(24)27-3/h6-12,16H,4-5,13H2,1-3H3 |
| InChIKey | RLTQTXTZICLLCM-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |