C15H22FNO2S — CID 103909616
methyl 2-fluoro-4-[[methyl(1-methylsulfanylbutan-2-yl)amino]methyl]benzoate (PubChem CID 103909616) has the molecular formula C15H22FNO2S and a molecular weight of 299.41 g/mol. Its IUPAC name is methyl 2-fluoro-4-[[methyl(1-methylsulfanylbutan-2-yl)amino]methyl]benzoate.
| Compound Name | methyl 2-fluoro-4-[[methyl(1-methylsulfanylbutan-2-yl)amino]methyl]benzoate |
|---|---|
| PubChem CID | 103909616 |
| Molecular Formula | C15H22FNO2S |
| Molecular Weight | 299.41 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | methyl 2-fluoro-4-[[methyl(1-methylsulfanylbutan-2-yl)amino]methyl]benzoate |
| SMILES | CCC(CSC)N(C)Cc1ccc(C(=O)OC)c(F)c1 |
| InChI | InChI=1S/C15H22FNO2S/c1-5-12(10-20-4)17(2)9-11-6-7-13(14(16)8-11)15(18)19-3/h6-8,12H,5,9-10H2,1-4H3 |
| InChIKey | QTYXRWGFCZMJOL-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.41 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |