C13H15FO6S — CID 106698985
methyl 2-fluoro-4-[(3-methoxy-3-oxopropyl)sulfonylmethyl]benzoate (PubChem CID 106698985) has the molecular formula C13H15FO6S and a molecular weight of 318.32 g/mol. Its IUPAC name is methyl 2-fluoro-4-[(3-methoxy-3-oxopropyl)sulfonylmethyl]benzoate.
| Compound Name | methyl 2-fluoro-4-[(3-methoxy-3-oxopropyl)sulfonylmethyl]benzoate |
|---|---|
| PubChem CID | 106698985 |
| Molecular Formula | C13H15FO6S |
| Molecular Weight | 318.32 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | methyl 2-fluoro-4-[(3-methoxy-3-oxopropyl)sulfonylmethyl]benzoate |
| SMILES | COC(=O)CCS(=O)(=O)Cc1ccc(C(=O)OC)c(F)c1 |
| InChI | InChI=1S/C13H15FO6S/c1-19-12(15)5-6-21(17,18)8-9-3-4-10(11(14)7-9)13(16)20-2/h3-4,7H,5-6,8H2,1-2H3 |
| InChIKey | AULRQZCOFMLDEZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |