C13H12FNO4 — CID 113254616
methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-2-fluorobenzoate (PubChem CID 113254616) has the molecular formula C13H12FNO4 and a molecular weight of 265.24 g/mol. Its IUPAC name is methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-2-fluorobenzoate.
| Compound Name | methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 113254616 |
| Molecular Formula | C13H12FNO4 |
| Molecular Weight | 265.24 g/mol |
| Exact Mass | 265.08 |
| IUPAC Name | methyl 4-[(2,5-dioxopyrrolidin-1-yl)methyl]-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(CN2C(=O)CCC2=O)cc1F |
| InChI | InChI=1S/C13H12FNO4/c1-19-13(18)9-3-2-8(6-10(9)14)7-15-11(16)4-5-12(15)17/h2-3,6H,4-5,7H2,1H3 |
| InChIKey | YHVOCTSTDWJQEL-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|