C16H22FNO2 — CID 103749510
methyl 4-[(2,5-dimethylpiperidin-1-yl)methyl]-2-fluorobenzoate (PubChem CID 103749510) has the molecular formula C16H22FNO2 and a molecular weight of 279.36 g/mol. Its IUPAC name is methyl 4-[(2,5-dimethylpiperidin-1-yl)methyl]-2-fluorobenzoate.
| Compound Name | methyl 4-[(2,5-dimethylpiperidin-1-yl)methyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 103749510 |
| Molecular Formula | C16H22FNO2 |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | methyl 4-[(2,5-dimethylpiperidin-1-yl)methyl]-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(CN2CC(C)CCC2C)cc1F |
| InChI | InChI=1S/C16H22FNO2/c1-11-4-5-12(2)18(9-11)10-13-6-7-14(15(17)8-13)16(19)20-3/h6-8,11-12H,4-5,9-10H2,1-3H3 |
| InChIKey | LRKXHVGOQKZEON-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |