C14H17FN2O3 — CID 103749383
methyl 4-[(3-carbamoylpyrrolidin-1-yl)methyl]-2-fluorobenzoate (PubChem CID 103749383) has the molecular formula C14H17FN2O3 and a molecular weight of 280.30 g/mol. Its IUPAC name is methyl 4-[(3-carbamoylpyrrolidin-1-yl)methyl]-2-fluorobenzoate.
| Compound Name | methyl 4-[(3-carbamoylpyrrolidin-1-yl)methyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 103749383 |
| Molecular Formula | C14H17FN2O3 |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | methyl 4-[(3-carbamoylpyrrolidin-1-yl)methyl]-2-fluorobenzoate |
| SMILES | COC(=O)c1ccc(CN2CCC(C(N)=O)C2)cc1F |
| InChI | InChI=1S/C14H17FN2O3/c1-20-14(19)11-3-2-9(6-12(11)15)7-17-5-4-10(8-17)13(16)18/h2-3,6,10H,4-5,7-8H2,1H3,(H2,16,18) |
| InChIKey | WFBOAFPMUHPRLE-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |