C16H22FNO3 — CID 103749261
methyl 4-[(4-ethoxypiperidin-1-yl)methyl]-2-fluorobenzoate (PubChem CID 103749261) has the molecular formula C16H22FNO3 and a molecular weight of 295.35 g/mol. Its IUPAC name is methyl 4-[(4-ethoxypiperidin-1-yl)methyl]-2-fluorobenzoate.
| Compound Name | methyl 4-[(4-ethoxypiperidin-1-yl)methyl]-2-fluorobenzoate |
|---|---|
| PubChem CID | 103749261 |
| Molecular Formula | C16H22FNO3 |
| Molecular Weight | 295.35 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | methyl 4-[(4-ethoxypiperidin-1-yl)methyl]-2-fluorobenzoate |
| SMILES | CCOC1CCN(Cc2ccc(C(=O)OC)c(F)c2)CC1 |
| InChI | InChI=1S/C16H22FNO3/c1-3-21-13-6-8-18(9-7-13)11-12-4-5-14(15(17)10-12)16(19)20-2/h4-5,10,13H,3,6-9,11H2,1-2H3 |
| InChIKey | UNNWKQWXYIUDQG-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |