C14H17FO5S — CID 107746480
methyl 2-fluoro-4-[(2-methyloxolan-3-yl)sulfonylmethyl]benzoate (PubChem CID 107746480) has the molecular formula C14H17FO5S and a molecular weight of 316.35 g/mol. Its IUPAC name is methyl 2-fluoro-4-[(2-methyloxolan-3-yl)sulfonylmethyl]benzoate.
| Compound Name | methyl 2-fluoro-4-[(2-methyloxolan-3-yl)sulfonylmethyl]benzoate |
|---|---|
| PubChem CID | 107746480 |
| Molecular Formula | C14H17FO5S |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | methyl 2-fluoro-4-[(2-methyloxolan-3-yl)sulfonylmethyl]benzoate |
| SMILES | COC(=O)c1ccc(CS(=O)(=O)C2CCOC2C)cc1F |
| InChI | InChI=1S/C14H17FO5S/c1-9-13(5-6-20-9)21(17,18)8-10-3-4-11(12(15)7-10)14(16)19-2/h3-4,7,9,13H,5-6,8H2,1-2H3 |
| InChIKey | DTNSKDQJXCVYJG-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |