C13H14F2O4S — CID 107764040
1-(2,5-difluorophenyl)-2-(2-methyloxolan-3-yl)sulfonylethanone (PubChem CID 107764040) has the molecular formula C13H14F2O4S and a molecular weight of 304.31 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-(2-methyloxolan-3-yl)sulfonylethanone.
| Compound Name | 1-(2,5-difluorophenyl)-2-(2-methyloxolan-3-yl)sulfonylethanone |
|---|---|
| PubChem CID | 107764040 |
| Molecular Formula | C13H14F2O4S |
| Molecular Weight | 304.31 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-(2-methyloxolan-3-yl)sulfonylethanone |
| SMILES | CC1OCCC1S(=O)(=O)CC(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H14F2O4S/c1-8-13(4-5-19-8)20(17,18)7-12(16)10-6-9(14)2-3-11(10)15/h2-3,6,8,13H,4-5,7H2,1H3 |
| InChIKey | QJFMCZMWVQWCKY-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.31 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |