C11H14O4S2 — CID 107764008
2-(2-methyloxolan-3-yl)sulfonyl-1-thiophen-2-ylethanone (PubChem CID 107764008) has the molecular formula C11H14O4S2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-(2-methyloxolan-3-yl)sulfonyl-1-thiophen-2-ylethanone.
| Compound Name | 2-(2-methyloxolan-3-yl)sulfonyl-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 107764008 |
| Molecular Formula | C11H14O4S2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 2-(2-methyloxolan-3-yl)sulfonyl-1-thiophen-2-ylethanone |
| SMILES | CC1OCCC1S(=O)(=O)CC(=O)c1cccs1 |
| InChI | InChI=1S/C11H14O4S2/c1-8-11(4-5-15-8)17(13,14)7-9(12)10-3-2-6-16-10/h2-3,6,8,11H,4-5,7H2,1H3 |
| InChIKey | SXJJWUNAINARID-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |