C13H18O2S2 — CID 103847347
4-(2-methyloxolan-3-yl)sulfanyl-1-thiophen-2-ylbutan-1-one (PubChem CID 103847347) has the molecular formula C13H18O2S2 and a molecular weight of 270.42 g/mol. Its IUPAC name is 4-(2-methyloxolan-3-yl)sulfanyl-1-thiophen-2-ylbutan-1-one.
| Compound Name | 4-(2-methyloxolan-3-yl)sulfanyl-1-thiophen-2-ylbutan-1-one |
|---|---|
| PubChem CID | 103847347 |
| Molecular Formula | C13H18O2S2 |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 4-(2-methyloxolan-3-yl)sulfanyl-1-thiophen-2-ylbutan-1-one |
| SMILES | CC1OCCC1SCCCC(=O)c1cccs1 |
| InChI | InChI=1S/C13H18O2S2/c1-10-12(6-7-15-10)16-8-2-4-11(14)13-5-3-9-17-13/h3,5,9-10,12H,2,4,6-8H2,1H3 |
| InChIKey | SCMZDBNTVPCNPZ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|