C13H18O2S — CID 15128597
6,6-dimethyl-1-thiophen-2-ylheptane-1,5-dione (PubChem CID 15128597) has the molecular formula C13H18O2S and a molecular weight of 238.35 g/mol. Its IUPAC name is 6,6-dimethyl-1-thiophen-2-ylheptane-1,5-dione.
| Compound Name | 6,6-dimethyl-1-thiophen-2-ylheptane-1,5-dione |
|---|---|
| PubChem CID | 15128597 |
| Molecular Formula | C13H18O2S |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 6,6-dimethyl-1-thiophen-2-ylheptane-1,5-dione |
| SMILES | CC(C)(C)C(=O)CCCC(=O)c1cccs1 |
| InChI | InChI=1S/C13H18O2S/c1-13(2,3)12(15)8-4-6-10(14)11-7-5-9-16-11/h5,7,9H,4,6,8H2,1-3H3 |
| InChIKey | KDPREOREKWFDGD-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |