C16H18O2S2 — CID 144689379
1-(5-tert-butylthiophen-2-yl)-4-thiophen-2-ylbutane-1,4-dione (PubChem CID 144689379) has the molecular formula C16H18O2S2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-(5-tert-butylthiophen-2-yl)-4-thiophen-2-ylbutane-1,4-dione.
| Compound Name | 1-(5-tert-butylthiophen-2-yl)-4-thiophen-2-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 144689379 |
| Molecular Formula | C16H18O2S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 1-(5-tert-butylthiophen-2-yl)-4-thiophen-2-ylbutane-1,4-dione |
| SMILES | CC(C)(C)c1ccc(C(=O)CCC(=O)c2cccs2)s1 |
| InChI | InChI=1S/C16H18O2S2/c1-16(2,3)15-9-8-14(20-15)12(18)7-6-11(17)13-5-4-10-19-13/h4-5,8-10H,6-7H2,1-3H3 |
| InChIKey | IRHSCGVTQZDSHT-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |