About butanoyl 4-oxo-4-thiophen-2-ylbutanoate
butanoyl 4-oxo-4-thiophen-2-ylbutanoate (PubChem CID 174440154) has the molecular formula C12H14O4S
and a molecular weight of 254.31 g/mol. Its IUPAC name is butanoyl 4-oxo-4-thiophen-2-ylbutanoate.
Molecular Properties
| Compound Name | butanoyl 4-oxo-4-thiophen-2-ylbutanoate |
| PubChem CID | 174440154 |
| Molecular Formula | C12H14O4S |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | butanoyl 4-oxo-4-thiophen-2-ylbutanoate |
| SMILES | CCCC(=O)OC(=O)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C12H14O4S/c1-2-4-11(14)16-12(15)7-6-9(13)10-5-3-8-17-10/h3,5,8H,2,4,6-7H2,1H3 |
| InChIKey | XMSHMKJPGBTFLV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze butanoyl 4-oxo-4-thiophen-2-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butanoyl 4-oxo-4-thiophen-2-ylbutanoate?
The IUPAC name of butanoyl 4-oxo-4-thiophen-2-ylbutanoate (CID 174440154) is butanoyl 4-oxo-4-thiophen-2-ylbutanoate.
What is the SMILES notation for butanoyl 4-oxo-4-thiophen-2-ylbutanoate?
The canonical SMILES for butanoyl 4-oxo-4-thiophen-2-ylbutanoate is CCCC(=O)OC(=O)CCC(=O)c1cccs1.
What is the InChIKey of butanoyl 4-oxo-4-thiophen-2-ylbutanoate?
The InChIKey is XMSHMKJPGBTFLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4S/c1-2-4-11(14)16-12(15)7-6-9(13)10-5-3-8-17-10/h3,5,8H,2,4,6-7H2,1H3.
What are the key properties of butanoyl 4-oxo-4-thiophen-2-ylbutanoate?
butanoyl 4-oxo-4-thiophen-2-ylbutanoate has a molecular weight of 254.31 g/mol, XLogP of 2.58, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butanoyl 4-oxo-4-thiophen-2-ylbutanoate is sourced from PubChem (CID 174440154), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).