C14H22OS — CID 114874097
1-(5-tert-butylthiophen-2-yl)-3-methylpentan-1-one (PubChem CID 114874097) has the molecular formula C14H22OS and a molecular weight of 238.40 g/mol. Its IUPAC name is 1-(5-tert-butylthiophen-2-yl)-3-methylpentan-1-one.
| Compound Name | 1-(5-tert-butylthiophen-2-yl)-3-methylpentan-1-one |
|---|---|
| PubChem CID | 114874097 |
| Molecular Formula | C14H22OS |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.14 |
| IUPAC Name | 1-(5-tert-butylthiophen-2-yl)-3-methylpentan-1-one |
| SMILES | CCC(C)CC(=O)c1ccc(C(C)(C)C)s1 |
| InChI | InChI=1S/C14H22OS/c1-6-10(2)9-11(15)12-7-8-13(16-12)14(3,4)5/h7-8,10H,6,9H2,1-5H3 |
| InChIKey | QWZSXAYSMGZUHU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |