C15H14Br2OS — CID 114023494
(5-tert-butylthiophen-2-yl)-(3,5-dibromophenyl)methanone (PubChem CID 114023494) has the molecular formula C15H14Br2OS and a molecular weight of 402.15 g/mol. Its IUPAC name is (5-tert-butylthiophen-2-yl)-(3,5-dibromophenyl)methanone.
| Compound Name | (5-tert-butylthiophen-2-yl)-(3,5-dibromophenyl)methanone |
|---|---|
| PubChem CID | 114023494 |
| Molecular Formula | C15H14Br2OS |
| Molecular Weight | 402.15 g/mol |
| Exact Mass | 399.91 |
| IUPAC Name | (5-tert-butylthiophen-2-yl)-(3,5-dibromophenyl)methanone |
| SMILES | CC(C)(C)c1ccc(C(=O)c2cc(Br)cc(Br)c2)s1 |
| InChI | InChI=1S/C15H14Br2OS/c1-15(2,3)13-5-4-12(19-13)14(18)9-6-10(16)8-11(17)7-9/h4-8H,1-3H3 |
| InChIKey | BMSCFVBEDYZBKE-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.15 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |