C18H18Br2O — CID 107979582
(3,5-dibromophenyl)-(2,3,4,5,6-pentamethylphenyl)methanone (PubChem CID 107979582) has the molecular formula C18H18Br2O and a molecular weight of 410.15 g/mol. Its IUPAC name is (3,5-dibromophenyl)-(2,3,4,5,6-pentamethylphenyl)methanone.
| Compound Name | (3,5-dibromophenyl)-(2,3,4,5,6-pentamethylphenyl)methanone |
|---|---|
| PubChem CID | 107979582 |
| Molecular Formula | C18H18Br2O |
| Molecular Weight | 410.15 g/mol |
| Exact Mass | 407.97 |
| IUPAC Name | (3,5-dibromophenyl)-(2,3,4,5,6-pentamethylphenyl)methanone |
| SMILES | Cc1c(C)c(C)c(C(=O)c2cc(Br)cc(Br)c2)c(C)c1C |
| InChI | InChI=1S/C18H18Br2O/c1-9-10(2)12(4)17(13(5)11(9)3)18(21)14-6-15(19)8-16(20)7-14/h6-8H,1-5H3 |
| InChIKey | ULUOVVOOMMYMHA-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.15 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |