C14H11Br2NO — CID 107981120
(4-amino-2-methylphenyl)-(3,5-dibromophenyl)methanone (PubChem CID 107981120) has the molecular formula C14H11Br2NO and a molecular weight of 369.06 g/mol. Its IUPAC name is (4-amino-2-methylphenyl)-(3,5-dibromophenyl)methanone.
| Compound Name | (4-amino-2-methylphenyl)-(3,5-dibromophenyl)methanone |
|---|---|
| PubChem CID | 107981120 |
| Molecular Formula | C14H11Br2NO |
| Molecular Weight | 369.06 g/mol |
| Exact Mass | 366.92 |
| IUPAC Name | (4-amino-2-methylphenyl)-(3,5-dibromophenyl)methanone |
| SMILES | Cc1cc(N)ccc1C(=O)c1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C14H11Br2NO/c1-8-4-12(17)2-3-13(8)14(18)9-5-10(15)7-11(16)6-9/h2-7H,17H2,1H3 |
| InChIKey | DKOKHTLOHGQIJS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.06 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|