C17H17Br2NO3 — CID 163793229
ethyl 4-(3,5-dibromobenzoyl)-1,3,5-trimethylpyrrole-2-carboxylate (PubChem CID 163793229) has the molecular formula C17H17Br2NO3 and a molecular weight of 443.14 g/mol. Its IUPAC name is ethyl 4-(3,5-dibromobenzoyl)-1,3,5-trimethylpyrrole-2-carboxylate.
| Compound Name | ethyl 4-(3,5-dibromobenzoyl)-1,3,5-trimethylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 163793229 |
| Molecular Formula | C17H17Br2NO3 |
| Molecular Weight | 443.14 g/mol |
| Exact Mass | 440.96 |
| IUPAC Name | ethyl 4-(3,5-dibromobenzoyl)-1,3,5-trimethylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(C(=O)c2cc(Br)cc(Br)c2)c(C)n1C |
| InChI | InChI=1S/C17H17Br2NO3/c1-5-23-17(22)15-9(2)14(10(3)20(15)4)16(21)11-6-12(18)8-13(19)7-11/h6-8H,5H2,1-4H3 |
| InChIKey | MYQFYZPCLWZGBN-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.14 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |